ethyl 6-(bromomethyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate structure
|
Common Name | ethyl 6-(bromomethyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 14903-94-7 | Molecular Weight | 263.08900 | |
| Density | 1.523g/cm3 | Boiling Point | 321ºC at 760 mmHg | |
| Molecular Formula | C8H11BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9ºC | |
| Name | ethyl 6-(bromomethyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523g/cm3 |
|---|---|
| Boiling Point | 321ºC at 760 mmHg |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.08900 |
| Flash Point | 147.9ºC |
| Exact Mass | 261.99500 |
| PSA | 70.92000 |
| LogP | 0.48010 |
| Vapour Pressure | 0.000306mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | XCSPAPSTDLJWOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CBr)NC(=O)NC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-bromomethyl-2-oxo-1,2,3,4-tetrahydro-pyrimidine-5-carboxylic acid ethyl ester |
| ethyl 6-(bromomethyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| 2-Oxo-5-ethoxycarbonyl-6-brommethyl-1.2.3.4-tetrahydro-pyrimidin |