Urechistachykinin II structure
|
Common Name | Urechistachykinin II | ||
|---|---|---|---|---|
| CAS Number | 149097-04-1 | Molecular Weight | 983.15 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H66N14O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Urechistachykinin IIUrechistachykinin II (Uru-TK II), an invertebrate tachykinin-related peptides (TRPs) isolated from echiuroid worms, shows antimicrobial activities without a hemolytic effect[1][2]. |
| Name | Urechistachykinin II |
|---|---|
| Synonym | More Synonyms |
| Description | Urechistachykinin II (Uru-TK II), an invertebrate tachykinin-related peptides (TRPs) isolated from echiuroid worms, shows antimicrobial activities without a hemolytic effect[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C44H66N14O10S |
| Molecular Weight | 983.15 |
| Exact Mass | 982.48100 |
| PSA | 418.21000 |
| LogP | 1.72750 |
| Index of Refraction | 1.647 |
| InChIKey | TUMKXKCPAKKYFR-XHMOLBPZSA-N |
| SMILES | CSCCC(NC(=O)CNC(=O)C(C)NC(=O)C(C)N)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NCC(=O)NC(C)C(=O)NC(CCCN=C(N)N)C(N)=O |
| uru-tk ii |
| h-ala-ala-gly-met-gly-phe-phe-gly-ala-arg-nh2 |
| ala-ala-gly-met-gly-phe-phe-gly-ala-arg-nh2 |
| urechistachykinin ii |
| aagmgffgar-nh2 |