Pyridine, 3,4-dinitro- structure
|
Common Name | Pyridine, 3,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 14916-69-9 | Molecular Weight | 169.09500 | |
| Density | 1.59g/cm3 | Boiling Point | 348.3ºC at 760mmHg | |
| Molecular Formula | C5H3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4ºC | |
| Name | 3,4-Dinitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 348.3ºC at 760mmHg |
| Molecular Formula | C5H3N3O4 |
| Molecular Weight | 169.09500 |
| Flash Point | 164.4ºC |
| Exact Mass | 169.01200 |
| PSA | 104.53000 |
| LogP | 1.94440 |
| Vapour Pressure | 0.000102mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | AGWLZVDRBYEOSR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccncc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine,3,4-dinitro |
| 3,4-Dinitropyridin |