(3R)-3-hydroxy-5-(hydroxy(phosphonooxy)phosphoryloxy)-3-methylpentanoic acid structure
|
Common Name | (3R)-3-hydroxy-5-(hydroxy(phosphonooxy)phosphoryloxy)-3-methylpentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1492-08-6 | Molecular Weight | 308.11700 | |
| Density | 1.778g/cm3 | Boiling Point | 626.4ºC at 760 mmHg | |
| Molecular Formula | C6H14O10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.6ºC | |
| Name | 3-hydroxy-5-[hydroxy(phosphonooxy)phosphoryl]oxy-3-methylpentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.778g/cm3 |
|---|---|
| Boiling Point | 626.4ºC at 760 mmHg |
| Molecular Formula | C6H14O10P2 |
| Molecular Weight | 308.11700 |
| Flash Point | 332.6ºC |
| Exact Mass | 308.00600 |
| PSA | 190.44000 |
| Vapour Pressure | 2.57E-18mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | SIGQQUBJQXSAMW-UHFFFAOYSA-N |
| SMILES | CC(O)(CCOP(=O)(O)OP(=O)(O)O)CC(=O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| D,L-Mevalonsaeure-5-pyrophosphat |
| 3-Hydroxy-5-pyrophosphonooxy-3-methyl-valeriansaeure |
| Mevalonsaeure-5-pyrophosphat |
| 5-Diphosphomevalonic acid |
| mevalonic acid 5-diphosphate |