4-[methyl[(nonafluorobutyl)sulphonyl]amino]butyl acrylate structure
|
Common Name | 4-[methyl[(nonafluorobutyl)sulphonyl]amino]butyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 1492-87-1 | Molecular Weight | 439.29400 | |
| Density | 1.451g/cm3 | Boiling Point | 332.5ºC at 760mmHg | |
| Molecular Formula | C12H14F9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.9ºC | |
| Name | 4-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]butyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 332.5ºC at 760mmHg |
| Molecular Formula | C12H14F9NO4S |
| Molecular Weight | 439.29400 |
| Flash Point | 154.9ºC |
| Exact Mass | 439.05000 |
| PSA | 72.06000 |
| LogP | 4.26390 |
| Vapour Pressure | 0.000145mmHg at 25°C |
| Index of Refraction | 1.397 |
| InChIKey | PGYDZCBTWHHAQX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2935009090 |
|---|
|
~%
4-[methyl[(nona... CAS#:1492-87-1 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2803615 , 1956 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| einecs 216-085-4 |