N-(4-butoxyphenyl)-1-(4-methoxyphenyl)methanimine structure
|
Common Name | N-(4-butoxyphenyl)-1-(4-methoxyphenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 14921-46-1 | Molecular Weight | 283.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-butoxyphenyl)-1-(4-methoxyphenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21NO2 |
|---|---|
| Molecular Weight | 283.36500 |
| Exact Mass | 283.15700 |
| PSA | 30.82000 |
| LogP | 4.62470 |
| InChIKey | ZYUOGTGULQBYNT-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(N=Cc2ccc(OC)cc2)cc1 |
|
~%
N-(4-butoxyphen... CAS#:14921-46-1 |
| Literature: Araya, K. Molecular Crystals and Liquid Crystals Science and Technology, Section A: Molecular Crystals and Liquid Crystals, 1994 , vol. 241, p. 249 - 254 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Methoxybenzylidene-p-n-butoxyaniline |
| <4-Methoxybenzal>-4-butoxy-anilin |