1-Benzenesulfonyl-3,5-diphenyl-7-azaindole
Modify Date: 2025-09-15 00:57:53
1-Benzenesulfonyl-3,5-diphenyl-7-azaindole structure
|
Common Name | 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole | ||
|---|---|---|---|---|
| CAS Number | 1492680-20-2 | Molecular Weight | 410.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H18N2O2S |
|---|---|
| Molecular Weight | 410.5 |
| InChIKey | GZGCHLKSTHETKH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2ccccc2)c2cc(-c3ccccc3)cnc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1492680-20-2? |
| A: Chinese name of 1492680-20-2 is 1492680-20-2. |
| Q: What is the molecular weight of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: Molecular weight of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is 410.5. |
| Q: What is the CAS number of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: CAS number of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is 1492680-20-2. |
| Q: What is the molecular formula of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: Molecular formula of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is C25H18N2O2S. |
| Q: What is the InChIKey of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: InChIKey of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is GZGCHLKSTHETKH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: SMILES notation of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is O=S(=O)(c1ccccc1)n1cc(-c2ccccc2)c2cc(-c3ccccc3)cnc21. |
| Q: What is the English name of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole? |
| A: The English name of 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole is 1-Benzenesulfonyl-3,5-diphenyl-7-azaindole. |