4-[(2-Methylbenzyl)oxy]benzoic acid
Modify Date: 2025-10-21 05:23:20
![4-[(2-Methylbenzyl)oxy]benzoic acid Structure](https://image.chemsrc.com/caspic/136/149289-01-0.png)
4-[(2-Methylbenzyl)oxy]benzoic acid structure
|
Common Name | 4-[(2-Methylbenzyl)oxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 149289-01-0 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-Methylbenzyl)oxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 3.27220 |
| InChIKey | YBAKJGNELKZYKS-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1COc1ccc(C(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(o-toluylamino)benzoyl chloride |
| 4-(2-methylbenzoylamino)benzoic acid chloride |
| 4-(2-methylbenzoylamino)benzoyl chloride |
| 4-(2-Methyl-benzyloxy)-benzoesaeure |
| Benzoyl chloride,4-[(2-methylbenzoyl)amino] |
| 4-(2-methyl-benzyloxy)-benzoic acid |