(S)-N-Cbz-propylglycinal
Modify Date: 2026-07-22 18:02:29
(S)-N-Cbz-propylglycinal structure
|
Common Name | (S)-N-Cbz-propylglycinal | ||
|---|---|---|---|---|
| CAS Number | 149357-16-4 | Molecular Weight | 235.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-N-Cbz-propylglycinal |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.27900 |
| Exact Mass | 235.12100 |
| PSA | 55.40000 |
| LogP | 2.67130 |
| InChIKey | QLICRBGTURRRJF-LBPRGKRZSA-N |
| SMILES | CCCC(C=O)NC(=O)OCc1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (S)-1-oxopentane-2-benzylcarbamate |
| (S)-2-benzyloxycarbonylaminopentanal |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (S)-N-Cbz-propylglycinal? |
| A: The English name of (S)-N-Cbz-propylglycinal is (S)-N-Cbz-propylglycinal. |
| Q: What is the LogP of (S)-N-Cbz-propylglycinal? |
| A: LogP of (S)-N-Cbz-propylglycinal is 2.67130. |
| Q: What is the molecular formula of (S)-N-Cbz-propylglycinal? |
| A: Molecular formula of (S)-N-Cbz-propylglycinal is C13H17NO3. |
| Q: What English synonyms does (S)-N-Cbz-propylglycinal have? |
| A: English synonyms of (S)-N-Cbz-propylglycinal: (S)-1-oxopentane-2-benzylcarbamate, (S)-2-benzyloxycarbonylaminopentanal. |
| Q: What is the CAS number of (S)-N-Cbz-propylglycinal? |
| A: CAS number of (S)-N-Cbz-propylglycinal is 149357-16-4. |
| Q: What is the InChIKey of (S)-N-Cbz-propylglycinal? |
| A: InChIKey of (S)-N-Cbz-propylglycinal is QLICRBGTURRRJF-LBPRGKRZSA-N. |
| Q: What is the polar surface area (PSA) of (S)-N-Cbz-propylglycinal? |
| A: Polar surface area (PSA) of (S)-N-Cbz-propylglycinal is 55.40000. |
| Q: What is the molecular weight of (S)-N-Cbz-propylglycinal? |
| A: Molecular weight of (S)-N-Cbz-propylglycinal is 235.27900. |
| Q: What is the SMILES notation of (S)-N-Cbz-propylglycinal? |
| A: SMILES notation of (S)-N-Cbz-propylglycinal is CCCC(C=O)NC(=O)OCc1ccccc1. |