2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate
Modify Date: 2026-07-06 20:17:23
![2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate Structure](https://www.chemsrc.com/extcaspic/181/149357-66-4.png)
2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate structure
|
Common Name | 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 149357-66-4 | Molecular Weight | 355.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H25NO6Si |
|---|---|
| Molecular Weight | 355.46 |
| InChIKey | QLPHDBDOLGEWRB-UHFFFAOYSA-N |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: Molecular weight of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is 355.46. |
| Q: What is the SMILES notation of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: SMILES notation of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is CC(CO[Si](C)(C)C(C)(C)C)OC(=O)Oc1ccc([N+](=O)[O-])cc1. |
| Q: What is the Chinese name of 149357-66-4? |
| A: Chinese name of 149357-66-4 is 149357-66-4. |
| Q: What is the English name of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: The English name of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate. |
| Q: What is the CAS number of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: CAS number of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is 149357-66-4. |
| Q: What is the molecular formula of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: Molecular formula of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is C16H25NO6Si. |
| Q: What is the InChIKey of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate? |
| A: InChIKey of 2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-methylethyl 4-nitrophenyl carbonate is QLPHDBDOLGEWRB-UHFFFAOYSA-N. |