5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)
Modify Date: 2025-08-20 11:35:01
5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) structure
|
Common Name | 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) | ||
|---|---|---|---|---|
| CAS Number | 14937-60-1 | Molecular Weight | 350.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N8O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14N8O6S |
|---|---|
| Molecular Weight | 350.32 |
| InChIKey | RLHWBKZWGWTCDS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1[nH]cnc1N.NC(=O)c1[nH]cnc1N.O=S(=O)(O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: Molecular formula of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is C8H14N8O6S. |
| Q: What is the SMILES notation of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: SMILES notation of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is NC(=O)c1[nH]cnc1N.NC(=O)c1[nH]cnc1N.O=S(=O)(O)O. |
| Q: What is the Chinese name of 14937-60-1? |
| A: Chinese name of 14937-60-1 is 14937-60-1. |
| Q: What is the English name of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: The English name of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1). |
| Q: What is the CAS number of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: CAS number of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is 14937-60-1. |
| Q: What is the InChIKey of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: InChIKey of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is RLHWBKZWGWTCDS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1)? |
| A: Molecular weight of 5-Amino-1H-imidazole-4-carboxamide,sulfate(2:1) is 350.32. |