α-[3-(Dimethylamino)propyl]-α-isopropyl-1-naphthaleneacetic acid cyclohexyl ester structure
|
Common Name | α-[3-(Dimethylamino)propyl]-α-isopropyl-1-naphthaleneacetic acid cyclohexyl ester | ||
|---|---|---|---|---|
| CAS Number | 14938-53-5 | Molecular Weight | 395.57700 | |
| Density | 1.04g/cm3 | Boiling Point | 513.9ºC at 760mmHg | |
| Molecular Formula | C26H37NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.9ºC | |
| Name | cyclohexyl 5-(dimethylamino)-2-naphthalen-1-yl-2-propan-2-ylpentanoate |
|---|
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 513.9ºC at 760mmHg |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.57700 |
| Flash Point | 140.9ºC |
| Exact Mass | 395.28200 |
| PSA | 29.54000 |
| LogP | 5.95130 |
| Vapour Pressure | 1.13E-10mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | AEVGXZZTAMVZAL-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCCN(C)C)(C(=O)OC1CCCCC1)c1cccc2ccccc12 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |