1,2,4,5-Tetrakis(dibromomethyl)benzene structure
|
Common Name | 1,2,4,5-Tetrakis(dibromomethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 14939-02-7 | Molecular Weight | 765.38700 | |
| Density | 2.908 | Boiling Point | 514.8ºC at 760 mmHg | |
| Molecular Formula | C10H6Br8 | Melting Point | 304-306ºC | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | 1,2,4,5-Tetrakis(dibromomethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.908 |
|---|---|
| Boiling Point | 514.8ºC at 760 mmHg |
| Melting Point | 304-306ºC |
| Molecular Formula | C10H6Br8 |
| Molecular Weight | 765.38700 |
| Flash Point | 254.9ºC |
| Exact Mass | 757.39400 |
| LogP | 8.84020 |
| Vapour Pressure | 3.4E-10mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | WNZJZWWTYRGCDI-UHFFFAOYSA-N |
| SMILES | BrC(Br)c1cc(C(Br)Br)c(C(Br)Br)cc1C(Br)Br |
| HS Code | 2903999090 |
|---|
|
~97%
1,2,4,5-Tetraki... CAS#:14939-02-7 |
| Literature: Shepherd, Michael K. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 961 - 970 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,4,5-tetra(dibromomethyl)benzene |
| 1,2,4,5-Tetrakis(dibrommethyl)benzol |
| Benzene,1,2,4,5-tetrakis(dibromomethyl) |
| 1,2,4,5-tetrakis (dibromomethyl)-benzene |