L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]
Modify Date: 2026-07-31 22:11:25
![L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] Structure](https://www.chemsrc.com/extcaspic/280/1496551-73-5.png)
L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] structure
|
Common Name | L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 1496551-73-5 | Molecular Weight | 217.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12ClN3O2 |
|---|---|
| Molecular Weight | 217.65 |
| InChIKey | AOKIHTDUPLUAPK-YFKPBYRVSA-N |
| SMILES | CC(NCc1ncc(Cl)n1C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: CAS number of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is 1496551-73-5. |
| Q: What is the English name of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: The English name of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]. |
| Q: What is the SMILES notation of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: SMILES notation of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is CC(NCc1ncc(Cl)n1C)C(=O)O. |
| Q: What is the molecular weight of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: Molecular weight of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is 217.65. |
| Q: What is the molecular formula of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: Molecular formula of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is C8H12ClN3O2. |
| Q: What is the InChIKey of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl]? |
| A: InChIKey of L-Alanine, N-[(5-chloro-1-methyl-1H-imidazol-2-yl)methyl] is AOKIHTDUPLUAPK-YFKPBYRVSA-N. |
| Q: What is the Chinese name of 1496551-73-5? |
| A: Chinese name of 1496551-73-5 is 1496551-73-5. |