2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline
2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline structure
|
Common Name | 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline | ||
|---|---|---|---|---|
| CAS Number | 149703-60-6 | Molecular Weight | 246.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N4O2 |
|---|---|
| Molecular Weight | 246.26500 |
| Exact Mass | 246.11200 |
| PSA | 83.63000 |
| LogP | 3.10110 |
| Index of Refraction | 1.668 |
| InChIKey | BEBDSPSEGFJNNE-UHFFFAOYSA-N |
| SMILES | CNc1c(C)cc2nc(C)c(C)nc2c1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3-Dimethyl-5-... CAS#:149703-60-6 |
| Literature: Grivas, Spiros; Tian, Wei; Ronne, Erik; Lindstroem, Stefan; Olsson, Kjell Acta Chemica Scandinavica, 1993 , vol. 47, # 5 p. 521 - 528 |
|
~%
2,3-Dimethyl-5-... CAS#:149703-60-6 |
| Literature: Grivas, Spiros; Tian, Wei; Ronne, Erik; Lindstroem, Stefan; Olsson, Kjell Acta Chemica Scandinavica, 1993 , vol. 47, # 5 p. 521 - 528 |
|
~%
2,3-Dimethyl-5-... CAS#:149703-60-6 |
| Literature: Grivas, Spiros; Tian, Wei; Ronne, Erik; Lindstroem, Stefan; Olsson, Kjell Acta Chemica Scandinavica, 1993 , vol. 47, # 5 p. 521 - 528 |
|
~%
2,3-Dimethyl-5-... CAS#:149703-60-6 |
| Literature: Grivas, Spiros; Tian, Wei; Ronne, Erik; Lindstroem, Stefan; Olsson, Kjell Acta Chemica Scandinavica, 1993 , vol. 47, # 5 p. 521 - 528 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,2,3,7-tetramethyl-5-nitroquinoxalin-6-amine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: Related upstream materials(CAS) of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline: 63155-04-4;2255-94-9;147021-84-9;149703-56-0. |
| Q: What is the polar surface area (PSA) of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: Polar surface area (PSA) of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is 83.63000. |
| Q: What is the Chinese name of 149703-60-6? |
| A: Chinese name of 149703-60-6 is 149703-60-6. |
| Q: What English synonyms does 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline have? |
| A: English synonyms of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline: N,2,3,7-tetramethyl-5-nitroquinoxalin-6-amine. |
| Q: What is the molecular formula of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: Molecular formula of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is C12H14N4O2. |
| Q: What is the InChIKey of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: InChIKey of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is BEBDSPSEGFJNNE-UHFFFAOYSA-N. |
| Q: What is the English name of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: The English name of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline. |
| Q: What is the CAS number of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: CAS number of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is 149703-60-6. |
| Q: What is the molecular weight of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: Molecular weight of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is 246.26500. |
| Q: What is the SMILES notation of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline? |
| A: SMILES notation of 2,3-Dimethyl-5-nitro-6-methylamino-7-methyl-quinoxaline is CNc1c(C)cc2nc(C)c(C)nc2c1[N+](=O)[O-]. |