5-METHYL-4-P-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL structure
|
Common Name | 5-METHYL-4-P-TOLYL-4H-[1,2,4]TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 149747-23-9 | Molecular Weight | 205.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Methyl-4-(4-methylphenyl)-4H-1,2,4-triazole-3-thiol |
|---|
| Molecular Formula | C10H11N3S |
|---|---|
| Molecular Weight | 205.27900 |
| Exact Mass | 205.06700 |
| PSA | 69.51000 |
| LogP | 2.17280 |
| InChIKey | AMEOKRGVIFDWLE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(C)n[nH]c2=S)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
5-METHYL-4-P-TO... CAS#:149747-23-9 |
| Literature: Wang, Zhiwei; Wu, Baogen; Kuhen, Kelli L.; Bursulaya, Badry; Nguyen, Truc N.; Nguyen, Deborah G.; He, Yun Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 16 p. 4174 - 4177 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |