9-(2-(hydroxymethyl)-1,3-oxathiolan-5-yl)hypoxanthine structure
|
Common Name | 9-(2-(hydroxymethyl)-1,3-oxathiolan-5-yl)hypoxanthine | ||
|---|---|---|---|---|
| CAS Number | 149819-61-4 | Molecular Weight | 254.266 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 658.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.0±34.3 °C | |
| Name | 9-[(2S,5R)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]-3,9-dihydro-6H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 658.4±65.0 °C at 760 mmHg |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.266 |
| Flash Point | 352.0±34.3 °C |
| Exact Mass | 254.047363 |
| LogP | -0.74 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.874 |
| InChIKey | NWAMVXFWUIMGLW-RITPCOANSA-N |
| SMILES | O=c1[nH]cnc2c1ncn2C1CSC(CO)O1 |
|
Name: Inhibition of cell growth against HIV-1 infected PBM (Human peripheral blood mononucl...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL757967
|
|
Name: Concentration required for antiviral activity in PBMC (human peripheral blood mononuc...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL759088
|
| 9-[(2S,5R)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]-3,9-dihydro-6H-purin-6-one |