Phosphinic acid,bis(2,2-dimethyl-1-aziridinyl)-, ethyl ester (8CI,9CI) structure
|
Common Name | Phosphinic acid,bis(2,2-dimethyl-1-aziridinyl)-, ethyl ester (8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 14984-65-7 | Molecular Weight | 232.26000 | |
| Density | 1.14g/cm3 | Boiling Point | 265.8ºC at 760mmHg | |
| Molecular Formula | C10H21N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | 1-[(2,2-dimethylaziridin-1-yl)-ethoxyphosphoryl]-2,2-dimethylaziridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 265.8ºC at 760mmHg |
| Molecular Formula | C10H21N2O2P |
| Molecular Weight | 232.26000 |
| Flash Point | 114.6ºC |
| Exact Mass | 232.13400 |
| PSA | 42.13000 |
| LogP | 2.19520 |
| Vapour Pressure | 0.00897mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | SOYAWOSQURUWHG-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(N1CC1(C)C)N1CC1(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| fda 1623 |
| ab-163 |