4-(dimethylamino)benzoyl chloride,hydrochloride structure
|
Common Name | 4-(dimethylamino)benzoyl chloride,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 149898-87-3 | Molecular Weight | 220.09600 | |
| Density | N/A | Boiling Point | 313.4ºC at 760mmHg | |
| Molecular Formula | C9H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.3ºC | |
| Name | 4-(dimethylamino)benzoyl chloride,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 313.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.09600 |
| Flash Point | 143.3ºC |
| Exact Mass | 219.02200 |
| PSA | 20.31000 |
| LogP | 2.93360 |
| Vapour Pressure | 0.000368mmHg at 25°C |
| InChIKey | AKWWGJAWIMCXCW-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)Cl)cc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Dimethylaminobenzoyl chloride HCl |
| 4-dimethylaminobenzoyl chloride hydrochloride |