6-{3-[2-cyano-1-cyclohexylamino-(E)-1-iminomethylamino]phenyl}-6-(3-pyridyl)-(E)-5-hexenoic acid
Modify Date: 2025-08-25 12:50:00
![6-{3-[2-cyano-1-cyclohexylamino-(E)-1-iminomethylamino]phenyl}-6-(3-pyridyl)-(E)-5-hexenoic acid Structure](https://www.chemsrc.com/extcaspic/302/149979-75-9.png)
6-{3-[2-cyano-1-cyclohexylamino-(E)-1-iminomethylamino]phenyl}-6-(3-pyridyl)-(E)-5-hexenoic acid structure
|
Common Name | 6-{3-[2-cyano-1-cyclohexylamino-(E)-1-iminomethylamino]phenyl}-6-(3-pyridyl)-(E)-5-hexenoic acid | ||
|---|---|---|---|---|
| CAS Number | 149979-75-9 | Molecular Weight | 431.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H29N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-{3-[2-cyano-1-cyclohexylamino-(E)-1-iminomethylamino]phenyl}-6-(3-pyridyl)-(E)-5-hexenoic acid |
|---|
| Molecular Formula | C25H29N5O2 |
|---|---|
| Molecular Weight | 431.5 |
| InChIKey | QGTKGOGDYIAADK-YDZHTSKRSA-N |
| SMILES | N#CNC(=NC1CCCCC1)Nc1cccc(C(=CCCCC(=O)O)c2cccnc2)c1 |
|
Name: In vitro activity on thromboxane A2 receptor antagonism in gel filtered human platele...
Source: ChEMBL
Target: Thromboxane A2 receptor
External Id: CHEMBL814726
|
|
Name: In vitro activity expressed as EC50 for inhibition of collagen induced platelet aggre...
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL698636
|
|
Name: In vitro activity on thromboxane A2 synthase inhibition in gel filtered human platele...
Source: ChEMBL
Target: Thromboxane-A synthase
External Id: CHEMBL813721
|
Total 3, Current Page 1 of 1
1