1-Benzyl-3-hydroxypiperidine-3-carbonitrile structure
|
Common Name | 1-Benzyl-3-hydroxypiperidine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 150018-99-8 | Molecular Weight | 216.27900 | |
| Density | 1.17g/cm3 | Boiling Point | 376.1ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | 1-Benzyl-3-hydroxypiperidine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 376.1ºC at 760 mmHg |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.27900 |
| Flash Point | 181.2ºC |
| Exact Mass | 216.12600 |
| PSA | 47.26000 |
| LogP | 1.47498 |
| Index of Refraction | 1.592 |
| InChIKey | ZGGPVFSWIRIZNF-UHFFFAOYSA-N |
| SMILES | N#CC1(O)CCCN(Cc2ccccc2)C1 |
| Storage condition | 2-8℃ |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Piperidinecarbonitrile,3-hydroxy-1-(phenylmethyl) |