Fmoc-glu(ochx)-oh structure
|
Common Name | Fmoc-glu(ochx)-oh | ||
|---|---|---|---|---|
| CAS Number | 150047-85-1 | Molecular Weight | 451.512 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 679.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.7±31.5 °C | |
| Name | (2S)-5-cyclohexyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 679.5±55.0 °C at 760 mmHg |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.512 |
| Flash Point | 364.7±31.5 °C |
| Exact Mass | 451.199493 |
| PSA | 101.93000 |
| LogP | 6.09 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | ODIPEUXZAYGDMU-QHCPKHFHSA-N |
| SMILES | O=C(CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)OC1CCCCC1 |
| Storage condition | Store at 0°C |
| (2S)-5-(Cyclohexyloxy)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-oxopentanoic acid |
| Glutamic acid, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 5-cyclohexyl ester |
| Fmoc-Glu(OcHx)-OH |
| AmbotzFAA1719 |
| Fmoc-Glu(ochex)-OH |