7H-Pyrrolo[2,3-d]pyrimidin-4-amine,5-phenyl- structure
|
Common Name | 7H-Pyrrolo[2,3-d]pyrimidin-4-amine,5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1501-13-9 | Molecular Weight | 210.23500 | |
| Density | 1.348g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.23500 |
| Exact Mass | 210.09100 |
| PSA | 67.59000 |
| LogP | 2.78830 |
| Index of Refraction | 1.75 |
| InChIKey | NQKXWFXNLQYDHZ-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2[nH]cc(-c3ccccc3)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-5-phenyl-pyrrolo<2.3-d>pyrimidin |