5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione
Modify Date: 2026-09-27 22:17:03
5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione structure
|
Common Name | 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1502139-02-7 | Molecular Weight | 230.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14O3 |
|---|---|
| Molecular Weight | 230.26 |
| InChIKey | HTLCHFWDFBUPTF-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)CC(c2ccc3c(c2)CCO3)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: Molecular formula of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is C14H14O3. |
| Q: What is the molecular weight of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: Molecular weight of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is 230.26. |
| Q: What is the CAS number of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: CAS number of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is 1502139-02-7. |
| Q: What is the English name of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: The English name of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione. |
| Q: What is the Chinese name of 1502139-02-7? |
| A: Chinese name of 1502139-02-7 is 1502139-02-7. |
| Q: What is the InChIKey of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: InChIKey of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is HTLCHFWDFBUPTF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione? |
| A: SMILES notation of 5-(2,3-Dihydrobenzofuran-5-yl)cyclohexane-1,3-dione is O=C1CC(=O)CC(c2ccc3c(c2)CCO3)C1. |