Dhoi-attac-cephem
Modify Date: 2025-09-09 16:29:32
Dhoi-attac-cephem structure
|
Common Name | Dhoi-attac-cephem | ||
|---|---|---|---|---|
| CAS Number | 150256-26-1 | Molecular Weight | 656.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28N6O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dhoi-attac-cephem |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H28N6O9S2 |
|---|---|
| Molecular Weight | 656.7 |
| InChIKey | RQENDQSLDGLZFP-BPNDJBKRSA-N |
| SMILES | CC(C)(ON=C(C(=O)NC1C(=O)N2CC(C=CCn3ccc4cc(=O)c(O)cc-4c3)(C(=O)O)CSC12)c1csc(N)n1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Dhoi-attac-cephem? |
| A: Molecular formula of Dhoi-attac-cephem is C28H28N6O9S2. |
| Q: What is the English name of Dhoi-attac-cephem? |
| A: The English name of Dhoi-attac-cephem is Dhoi-attac-cephem. |
| Q: What is the SMILES notation of Dhoi-attac-cephem? |
| A: SMILES notation of Dhoi-attac-cephem is CC(C)(ON=C(C(=O)NC1C(=O)N2CC(C=CCn3ccc4cc(=O)c(O)cc-4c3)(C(=O)O)CSC12)c1csc(N)n1)C(=O)O. |
| Q: What is the InChIKey of Dhoi-attac-cephem? |
| A: InChIKey of Dhoi-attac-cephem is RQENDQSLDGLZFP-BPNDJBKRSA-N. |
| Q: What is the molecular weight of Dhoi-attac-cephem? |
| A: Molecular weight of Dhoi-attac-cephem is 656.7. |
| Q: What is the Chinese name of 150256-26-1? |
| A: Chinese name of 150256-26-1 is 150256-26-1. |
| Q: What is the CAS number of Dhoi-attac-cephem? |
| A: CAS number of Dhoi-attac-cephem is 150256-26-1. |