4,5,7-Trichloroquinoline-3-carboxylic acid ethyl ester structure
|
Common Name | 4,5,7-Trichloroquinoline-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 150258-21-2 | Molecular Weight | 304.55600 | |
| Density | 1.471g/cm3 | Boiling Point | 389.3ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | ethyl 4,5,7-trichloroquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760 mmHg |
| Molecular Formula | C12H8Cl3NO2 |
| Molecular Weight | 304.55600 |
| Flash Point | 189.2ºC |
| Exact Mass | 302.96200 |
| PSA | 39.19000 |
| LogP | 4.37170 |
| Vapour Pressure | 2.88E-06mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | JUHHXTUPYVWFKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2cc(Cl)cc(Cl)c2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6J-054 |
| ethyl 4,5,7-trichloro-3-quinolinecarboxylate |