Ethyl 4-[(cyanoacetyl)amino]benzoate structure
|
Common Name | Ethyl 4-[(cyanoacetyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 15029-53-5 | Molecular Weight | 232.235 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 470.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4±24.6 °C | |
| Name | ethyl 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.6±30.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.235 |
| Flash Point | 238.4±24.6 °C |
| Exact Mass | 232.084793 |
| PSA | 79.19000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | KQSPTNNCXGBAKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC#N)cc1 |
| HS Code | 2926909090 |
|---|
|
~29%
Ethyl 4-[(cyano... CAS#:15029-53-5 |
| Literature: Schellhase; Bohm; Pech Pharmazie, 1984 , vol. 39, # 1 p. 19 - 21 |
|
~16%
Ethyl 4-[(cyano... CAS#:15029-53-5 |
| Literature: Poradosu, Enrique; Gazit, Aviv; Reuveni, Hadas; Levitzki, Alexander Bioorganic and Medicinal Chemistry, 1999 , vol. 7, # 8 p. 1727 - 1736 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethyl 4-[(cyanoacetyl)amino]benzoate |
| 4-[(2-Cyanoacetyl)amino]benzoic acid ethyl ester |
| 4-(2-Cyano-acetylamino)-benzoic acid ethyl ester |
| N-(4-Aethoxycarbonyl-phenyl)-cyanacetamid |
| Benzoic acid, 4-[(2-cyanoacetyl)amino]-, ethyl ester |