tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 150349-65-8 | Molecular Weight | 242.35800 | |
| Density | 0.999g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C13H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
| Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.35800 |
| Flash Point | 154.7ºC |
| Exact Mass | 242.19900 |
| PSA | 55.56000 |
| LogP | 3.01060 |
| Vapour Pressure | 0.000149mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | QZYIDMYWRACBRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCN)CC1 |
| Water Solubility | Slightly soluble (2.1 g/L) (25 ºC) |
| HS Code | 2933399090 |
|---|
|
~94%
tert-butyl 4-(3... CAS#:150349-65-8 |
| Literature: RITCHER GEDEON NYRT Patent: WO2008/50168 A1, 2008 ; Location in patent: Page/Page column 29 ; WO 2008/050168 A1 |
|
~%
tert-butyl 4-(3... CAS#:150349-65-8 |
| Literature: US5494921 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-Aminopropyl)piperidine-1-carboxylic acid tert-butyl ester |
| 1-Boc-4-(3-aminopropyl)piperidine |