m-(3-Butyl-1-methyl-3-pyrrolidinyl)phenol structure
|
Common Name | m-(3-Butyl-1-methyl-3-pyrrolidinyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 1505-39-1 | Molecular Weight | 233.34900 | |
| Density | 1.008g/cm3 | Boiling Point | 351ºC at 760mmHg | |
| Molecular Formula | C15H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.2ºC | |
| Name | 3-(3-butyl-1-methylpyrrolidin-3-yl)phenol |
|---|
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760mmHg |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.34900 |
| Flash Point | 157.2ºC |
| Exact Mass | 233.17800 |
| PSA | 23.47000 |
| LogP | 3.09360 |
| Vapour Pressure | 2.09E-05mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | FYZBHPKQZFGKAR-UHFFFAOYSA-N |
| SMILES | CCCCC1(c2cccc(O)c2)CCN(C)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |