α-[2-[Benzyl(methyl)amino]ethyl]-α-isopropyl-1-naphthaleneacetamide structure
|
Common Name | α-[2-[Benzyl(methyl)amino]ethyl]-α-isopropyl-1-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 1505-89-1 | Molecular Weight | 215.76300 | |
| Density | 1.095g/cm3 | Boiling Point | 561ºC at 760 mmHg | |
| Molecular Formula | C12H22ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.1ºC | |
| Name | N,N-bis(prop-2-enyl)cyclohexanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 561ºC at 760 mmHg |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.76300 |
| Flash Point | 293.1ºC |
| Exact Mass | 215.14400 |
| PSA | 3.24000 |
| LogP | 3.79510 |
| Vapour Pressure | 1.3E-12mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | MXLCXWPNZGESLV-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCN(C)Cc1ccccc1)(C(N)=O)c1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 238-893-6 |
| Diallylcyclohexylamine hydrochloride |
| N,N-Diallylcyclohexylamine hydrochloride |