α-Isopropyl-α-(2-piperidinoethyl)-1-naphthaleneacetamide structure
|
Common Name | α-Isopropyl-α-(2-piperidinoethyl)-1-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 1505-96-0 | Molecular Weight | 338.48600 | |
| Density | 1.076g/cm3 | Boiling Point | 547ºC at 760mmHg | |
| Molecular Formula | C22H30N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.6ºC | |
| Name | 3-methyl-2-naphthalen-1-yl-2-(2-piperidin-1-ylethyl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 547ºC at 760mmHg |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.48600 |
| Flash Point | 284.6ºC |
| Exact Mass | 338.23600 |
| PSA | 47.32000 |
| LogP | 5.18250 |
| Vapour Pressure | 5.1E-12mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | RTNXNRZZXYBWJZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCN1CCCCC1)(C(N)=O)c1cccc2ccccc12 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-isopropyl-2-naphthalen-1-yl-4-piperidin-1-yl-butyramide |