Ethyl 6-methoxy-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 6-methoxy-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 15050-04-1 | Molecular Weight | 219.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 380.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | 135-136 °C | |
| MSDS | N/A | Flash Point | 183.7±22.3 °C | |
| Name | Ethyl 6-methoxy-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.2±22.0 °C at 760 mmHg |
| Melting Point | 135-136 °C |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.236 |
| Flash Point | 183.7±22.3 °C |
| Exact Mass | 219.089539 |
| PSA | 51.32000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | HYFAOIAKHGVBMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(OC)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 6-methoxy-1H-indole-2-carboxylate |
| 6-Methoxy-1H-indole-2-carboxylic acid ethyl ester |
| 6-Methoxy-indol-2-carbonsaeure-aethylester |
| 6-methoxy-2-carbethoxyindole |
| Indole-2-carboxylic acid, 6-methoxy-, ethyl ester |
| 1H-Indole-2-carboxylic acid, 6-methoxy-, ethyl ester |
| ethyl 6-methoxy-indole-2-carboxylate |
| Indole-2-carboxylic acid,6-methoxy-,ethyl ester |
| 6-methoxy-indole-2-carboxylic acid ethyl ester |