Bicyclo[2.2.1]heptan-2-one,3-(hydroxymethylene)-1,7,7-trimethyl
Modify Date: 2025-08-25 23:49:11
![Bicyclo[2.2.1]heptan-2-one,3-(hydroxymethylene)-1,7,7-trimethyl Structure](https://image.chemsrc.com/caspic/347/15051-75-9.png)
Bicyclo[2.2.1]heptan-2-one,3-(hydroxymethylene)-1,7,7-trimethyl structure
|
Common Name | Bicyclo[2.2.1]heptan-2-one,3-(hydroxymethylene)-1,7,7-trimethyl | ||
|---|---|---|---|---|
| CAS Number | 15051-75-9 | Molecular Weight | 180.24400 | |
| Density | 1.177g/cm3 | Boiling Point | 265.5ºC at 760mmHg | |
| Molecular Formula | C11H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.4ºC | |
| Name | (2Z)-2-(hydroxymethylidene)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 265.5ºC at 760mmHg |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.24400 |
| Flash Point | 110.4ºC |
| Exact Mass | 180.11500 |
| PSA | 37.30000 |
| LogP | 2.45350 |
| Vapour Pressure | 0.00126mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | DFCLRLMPUDXMII-SREVYHEPSA-N |
| SMILES | CC12CCC(C(=CO)C1=O)C2(C)C |
CAS#:110-45-2![1,7,7-trimethyl-bicyclo[2.2.1]heptane-2-one Structure](https://image.chemsrc.com/caspic/166/736109-58-3.png)
CAS#:736109-58-3![2-diazonio-4,7,7-trimethylbicyclo[2.2.1]hept-2-en-3-olate structure](https://image.chemsrc.com/caspic/405/14487-70-8.png)
CAS#:14487-70-8
CAS#:20618-41-1|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 3-Hydroxymethylen-bornan-2-on |
| 2-Oxo-3-hydroxymethylen-1,7,7-trimethyl-norbornan |
| 4,7,7-trimethyl-3-oxo-norbornane-2-carbaldehyde |
| 4,7,7-Trimethyl-3-oxo-norbornan-2-carbaldehyd |
| 3-Hydroxymethylenecamphor |