2,5-Cyclohexadien-1-one,2,6-bis(1,1-dimethylethyl)-4-(ethyl-aci-nitro)- structure
|
Common Name | 2,5-Cyclohexadien-1-one,2,6-bis(1,1-dimethylethyl)-4-(ethyl-aci-nitro)- | ||
|---|---|---|---|---|
| CAS Number | 15052-29-6 | Molecular Weight | 279.37500 | |
| Density | 1.02g/cm3 | Boiling Point | 364.9ºC at 760mmHg | |
| Molecular Formula | C16H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.3ºC | |
| Name | 3,5-ditert-butyl-N-ethoxy-4-oxocyclohexa-2,5-dien-1-imine oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 364.9ºC at 760mmHg |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.37500 |
| Flash Point | 126.3ºC |
| Exact Mass | 279.18300 |
| PSA | 55.05000 |
| LogP | 3.94010 |
| Vapour Pressure | 1.63E-05mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | XHJCAFOKDUXTBC-UHFFFAOYSA-N |
| SMILES | CCO[N+](=O)c1cc(C(C)(C)C)c([O-])c(C(C)(C)C)c1 |
|
~%
2,5-Cyclohexadi... CAS#:15052-29-6 |
| Literature: Meek,J.S.; Powler,J.S. Journal of Organic Chemistry, 1968 , vol. 33, p. 226 - 229 |
| 3,5-Di-tert.-butyl-4-oxo-2,5-cyclohexadien-nitronsaeure-aethylester |
| 4-(ethyl-aci-nitro)-2,6-di-t-butylcyclohexa-2,5-dienone |