N-[(1,3-dioxoisoindol-2-yl)methyl]acetamide structure
|
Common Name | N-[(1,3-dioxoisoindol-2-yl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 15059-09-3 | Molecular Weight | 218.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(1,3-dioxoisoindol-2-yl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N2O3 |
|---|---|
| Molecular Weight | 218.20900 |
| Exact Mass | 218.06900 |
| PSA | 69.97000 |
| LogP | 1.15440 |
| InChIKey | OCEWJOCKPJHLHX-UHFFFAOYSA-N |
| SMILES | CC(=O)NCN1C(=O)c2ccccc2C1=O |
|
~%
N-[(1,3-dioxois... CAS#:15059-09-3 |
| Literature: Buc Journal of the American Chemical Society, 1947 , vol. 69, p. 254 |
|
~%
N-[(1,3-dioxois... CAS#:15059-09-3 |
| Literature: Buc Journal of the American Chemical Society, 1947 , vol. 69, p. 254 |
|
~%
N-[(1,3-dioxois... CAS#:15059-09-3 |
| Literature: Buc Journal of the American Chemical Society, 1947 , vol. 69, p. 254 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Phthalimidomethylacetamid |