2-methylprop-2-enoic acid,methyl 3-sulfanylpropanoate,styrene structure
|
Common Name | 2-methylprop-2-enoic acid,methyl 3-sulfanylpropanoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 150632-04-5 | Molecular Weight | 310.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylprop-2-enoic acid,methyl 3-sulfanylpropanoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H22O4S |
|---|---|
| Molecular Weight | 310.40800 |
| Exact Mass | 310.12400 |
| PSA | 102.40000 |
| LogP | 3.45600 |
| InChIKey | JWNKGDVVDGGXMZ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=Cc1ccccc1.COC(=O)CCS |
| 2-Propenoic acid,2-methyl-,telomer with ethenylbenzene and methyl 3-mercaptopropanoate |