4-Methyl-6,7-methylenedioxycoumarin structure
|
Common Name | 4-Methyl-6,7-methylenedioxycoumarin | ||
|---|---|---|---|---|
| CAS Number | 15071-04-2 | Molecular Weight | 204.179 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 369.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H8O4 | Melting Point | 181ºC | |
| MSDS | N/A | Flash Point | 168.0±27.9 °C | |
| Name | 4-Methyl-6,7-methylenedioxycoumarin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.7±42.0 °C at 760 mmHg |
| Melting Point | 181ºC |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.179 |
| Flash Point | 168.0±27.9 °C |
| Exact Mass | 204.042252 |
| PSA | 48.67000 |
| LogP | 2.47 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | XAOGHIKJQRXPHX-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc3c(cc12)OCO3 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6H-1,3-Dioxolo[4,5-g][1]benzopyran-6-one, 8-methyl- |
| 4-Methyl-6,7-methylenedioxycoumarin |
| 4-Methylayapin |
| 8-methyl-[1,3]dioxolo[4,5-g]chromen-6-one |
| 8-Methyl-6H-[1,3]dioxolo[4,5-g]chromen-6-one |