1-Methyl-4-[2-[(3-methyl-1-phenyl-1H-pyrazol-5-yl)oxy]ethyl]piperazine structure
|
Common Name | 1-Methyl-4-[2-[(3-methyl-1-phenyl-1H-pyrazol-5-yl)oxy]ethyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 15083-52-0 | Molecular Weight | 300.39900 | |
| Density | 1.14g/cm3 | Boiling Point | 444.7ºC at 760 mmHg | |
| Molecular Formula | C17H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | 1-methyl-4-[2-(5-methyl-2-phenylpyrazol-3-yl)oxyethyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760 mmHg |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.39900 |
| Flash Point | 222.8ºC |
| Exact Mass | 300.19500 |
| PSA | 33.53000 |
| LogP | 1.68270 |
| Vapour Pressure | 4.18E-08mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | XAJSPFVSHSICAZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCCN2CCN(C)CC2)n(-c2ccccc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-324 |