9-(2-deoxy-2-fluororibofuranosyl)-2-iodo-6-methoxypurine structure
|
Common Name | 9-(2-deoxy-2-fluororibofuranosyl)-2-iodo-6-methoxypurine | ||
|---|---|---|---|---|
| CAS Number | 150863-85-7 | Molecular Weight | 410.14000 | |
| Density | 2.32g/cm3 | Boiling Point | 668.2ºC at 760mmHg | |
| Molecular Formula | C11H12FIN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.9ºC | |
| Name | (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-(2-iodo-6-methoxypurin-9-yl)oxolan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.32g/cm3 |
|---|---|
| Boiling Point | 668.2ºC at 760mmHg |
| Molecular Formula | C11H12FIN4O4 |
| Molecular Weight | 410.14000 |
| Flash Point | 357.9ºC |
| Exact Mass | 409.98900 |
| PSA | 102.52000 |
| LogP | 0.02820 |
| Vapour Pressure | 9.08E-19mmHg at 25°C |
| Index of Refraction | 1.802 |
| InChIKey | RZNPNDVANHIBAN-QYYRPYCUSA-N |
| SMILES | COc1nc(I)nc2c1ncn2C1OC(CO)C(O)C1F |
|
~71%
9-(2-deoxy-2-fl... CAS#:150863-85-7 |
| Literature: Maruyama; Utsumi; Sato; Richman Nucleosides and Nucleotides, 1994 , vol. 13, # 6-7 p. 1219 - 1230 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2I-2'F6MeO-Pur |
| 9-Dfr-2-I-6-MP |