ethyl 4-hydroxy-1-phenyl-5-(phenylazo)-1H-pyrazole-3-carboxylate structure
|
Common Name | ethyl 4-hydroxy-1-phenyl-5-(phenylazo)-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 15096-02-3 | Molecular Weight | 336.34500 | |
| Density | 1.28g/cm3 | Boiling Point | 459.3ºC at 760mmHg | |
| Molecular Formula | C18H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.6ºC | |
| Name | ethyl (5Z)-4-oxo-1-phenyl-5-(phenylhydrazinylidene)pyrazole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 459.3ºC at 760mmHg |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.34500 |
| Flash Point | 231.6ºC |
| Exact Mass | 336.12200 |
| PSA | 83.36000 |
| LogP | 1.99400 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | OWYTYDUDULWGQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(N=Nc2ccccc2)c1O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Carbethoxy-1-phenyl-5-phenylazo-4-pyrazolon |
| 4-hydroxy-1-phenyl-5-phenylazo-1H-pyrazole-3-carboxylic acid ethyl ester |
| EINECS 239-146-7 |
| 1-Phenyl-3-carbethoxy-5-phenylazo-4-pyrazolon |