methyl 3,5-dibromo-2,4-dimethoxy-6-methylbenzoate structure
|
Common Name | methyl 3,5-dibromo-2,4-dimethoxy-6-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 150965-73-4 | Molecular Weight | 368.01900 | |
| Density | 1.643g/cm3 | Boiling Point | 398ºC at 760mmHg | |
| Molecular Formula | C11H12Br2O4 | Melting Point | 59-60ºC | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | methyl 3,5-dibromo-2,4-dimethoxy-6-methylbenzoate |
|---|
| Density | 1.643g/cm3 |
|---|---|
| Boiling Point | 398ºC at 760mmHg |
| Melting Point | 59-60ºC |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.01900 |
| Flash Point | 194.5ºC |
| Exact Mass | 365.91000 |
| PSA | 44.76000 |
| LogP | 3.32380 |
| Vapour Pressure | 1.52E-06mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | HCKWDQNSOKQKEN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)c(Br)c(OC)c(Br)c1OC |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2918990090 |
|
~97%
methyl 3,5-dibr... CAS#:150965-73-4 |
| Literature: Saimoto; Ueda; Sashiwa; Shigemasa; Hiyama Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 4 p. 1178 - 1185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |