Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)
Modify Date: 2026-08-06 19:08:53
Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) structure
|
Common Name | Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) | ||
|---|---|---|---|---|
| CAS Number | 1509812-33-2 | Molecular Weight | 426.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18Br2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18Br2N2O2S |
|---|---|
| Molecular Weight | 426.17 |
| InChIKey | ZXYUGUZAHFTUPC-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NC2CCCN(C)C2)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: Molecular weight of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is 426.17. |
| Q: What is the Chinese name of 1509812-33-2? |
| A: Chinese name of 1509812-33-2 is 1509812-33-2. |
| Q: What is the CAS number of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: CAS number of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is 1509812-33-2. |
| Q: What is the InChIKey of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: InChIKey of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is ZXYUGUZAHFTUPC-UHFFFAOYSA-N. |
| Q: What is the English name of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: The English name of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl). |
| Q: What is the SMILES notation of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: SMILES notation of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is Cc1cc(Br)c(S(=O)(=O)NC2CCCN(C)C2)cc1Br. |
| Q: What is the molecular formula of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl)? |
| A: Molecular formula of Benzenesulfonamide, 2,5-dibromo-4-methyl-N-(1-methyl-3-piperidinyl) is C13H18Br2N2O2S. |