CID 126628848
Modify Date: 2025-09-27 16:10:51
CID 126628848 structure
|
Common Name | CID 126628848 | ||
|---|---|---|---|---|
| CAS Number | 1509899-70-0 | Molecular Weight | 364.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClF3N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 126628848 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16ClF3N2OS |
|---|---|
| Molecular Weight | 364.8 |
| InChIKey | LQOJJEBLPULPJO-ZAMGYDSWSA-N |
| SMILES | CC(C)(C)S(=O)NC(c1ccc2cnc(Cl)cc2c1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of CID 126628848? |
| A: Molecular weight of CID 126628848 is 364.8. |
| Q: What is the English name of CID 126628848? |
| A: The English name of CID 126628848 is CID 126628848. |
| Q: What is the InChIKey of CID 126628848? |
| A: InChIKey of CID 126628848 is LQOJJEBLPULPJO-ZAMGYDSWSA-N. |
| Q: What is the CAS number of CID 126628848? |
| A: CAS number of CID 126628848 is 1509899-70-0. |
| Q: What is the SMILES notation of CID 126628848? |
| A: SMILES notation of CID 126628848 is CC(C)(C)S(=O)NC(c1ccc2cnc(Cl)cc2c1)C(F)(F)F. |
| Q: What is the Chinese name of 1509899-70-0? |
| A: Chinese name of 1509899-70-0 is 1509899-70-0. |
| Q: What is the molecular formula of CID 126628848? |
| A: Molecular formula of CID 126628848 is C15H16ClF3N2OS. |