(R)-N-Cbz-3,4-dihydro-1H-isoquinolinecarboxylic acid structure
|
Common Name | (R)-N-Cbz-3,4-dihydro-1H-isoquinolinecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 151004-88-5 | Molecular Weight | 311.33200 | |
| Density | 1.308g/cm3 | Boiling Point | 521.6ºC at 760 mmHg | |
| Molecular Formula | C18H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.2ºC | |
| Name | (R)-N-Cbz-3,4-dihydro-1H-isoquinolinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 521.6ºC at 760 mmHg |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.33200 |
| Flash Point | 269.2ºC |
| Exact Mass | 311.11600 |
| PSA | 66.84000 |
| LogP | 2.94510 |
| Vapour Pressure | 1.05E-11mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ACQYZSFXPXXIHL-MRXNPFEDSA-N |
| SMILES | O=C(O)C1c2ccccc2CCN1C(=O)OCc1ccccc1 |
| HS Code | 2933499090 |
|---|
|
~59%
(R)-N-Cbz-3,4-d... CAS#:151004-88-5 |
| Literature: Wang, Sa; Seto, Christopher T. Organic Letters, 2006 , vol. 8, # 18 p. 3979 - 3982 |
|
~%
(R)-N-Cbz-3,4-d... CAS#:151004-88-5 |
| Literature: WO2005/7164 A1, ; Page 55 ; WO 2005/007164 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1R)-2-phenylmethoxycarbonyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |