Xanthoquinodin A1 structure
|
Common Name | Xanthoquinodin A1 | ||
|---|---|---|---|---|
| CAS Number | 151063-27-3 | Molecular Weight | 572.516 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 859.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C31H24O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.9±27.8 °C | |
Use of Xanthoquinodin A1Xanthoquinodin A1 is an anticoccidial antibiotic having a new xanthone-anthraquinone conjugate system[1]. |
| Name | Xanthoquinodin A1 |
|---|---|
| Synonym | More Synonyms |
| Description | Xanthoquinodin A1 is an anticoccidial antibiotic having a new xanthone-anthraquinone conjugate system[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 859.6±65.0 °C at 760 mmHg |
| Molecular Formula | C31H24O11 |
| Molecular Weight | 572.516 |
| Flash Point | 286.9±27.8 °C |
| Exact Mass | 572.131836 |
| LogP | 6.06 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.793 |
| InChIKey | XCWGCTNGDUDAMO-SLAVHBLRSA-N |
| SMILES | COC(=O)C12Oc3cc4c(c(O)c3C(O)=C1C(=O)CCC2O)C1C=CC2(C4)C(=O)c3cc(C)cc(O)c3C(O)=C2C1=O |
| Methyl (1R,7R,8S,17S)-8,11,15,18,22-pentahydroxy-24-methyl-13,20,27-trioxo-6-oxaheptacyclo[15.10.2.01,19.03,16.05,14.07,12.021,26]nonacosa-3(16),4,11,14,18,21,23,25,28-nonaene-7-carboxylate |
| 4aH-7a,15-Ethenonaphtho[2',3':4,5]cyclohepta[1,2-b]xanthene-4a-carboxylic acid, 2,3,4,7,8,13,15,17-octahydro-1,4,12,14,16-pentahydroxy-10-methyl-8,13,17-trioxo-, methyl ester, (4S,4aR,7aR,15S)- |
| Xanthoquinodin A1 |