Primin structure
|
Common Name | Primin | ||
|---|---|---|---|---|
| CAS Number | 15121-94-5 | Molecular Weight | 208.254 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 316.9±31.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | 77-79 °C | |
| MSDS | N/A | Flash Point | 137.7±24.9 °C | |
Use of PriminPrimin is a natural product stored in trichomes on leaves and stems of Primula obconica, with antimicrobial and antitumour properties[1][2]. |
| Name | primin |
|---|---|
| Synonym | More Synonyms |
| Description | Primin is a natural product stored in trichomes on leaves and stems of Primula obconica, with antimicrobial and antitumour properties[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.9±31.0 °C at 760 mmHg |
| Melting Point | 77-79 °C |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.254 |
| Flash Point | 137.7±24.9 °C |
| Exact Mass | 208.109940 |
| PSA | 43.37000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | WLWIMKWZMGJRBS-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=O)C=C(OC)C1=O |
| HS Code | 2933199011 |
|---|
| HS Code | 2933199011 |
|---|---|
| Summary | 2933199011 2-methoxy-6-pentylcyclohexa-2,5-diene-1,4-dione。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
| Primin |
| 2-methoxy-6-pentylcyclohexa-2,5-diene-1,4-dione |
| 2-methoxy-6-pentyl-2,5-cyclohexadiene-1,4-dione |
| 2,5-Cyclohexadiene-1,4-dione, 2-methoxy-6-pentyl- |
| 2-methoxy-6-n-pentyl-1,4-benzoquinone |
| 2-Methoxy-6-pentyl-1,4-benzoquinone |
| 2-methoxy-6-n-pentyl-p-benzoquinone |
| 2-Methoxy-6-n-pentyl-1,4-benzochinon |