5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& structure
|
Common Name | 5 5''''-DIHEXYL-2 2':5' 2'':5'' 2''':5'& | ||
|---|---|---|---|---|
| CAS Number | 151271-43-1 | Molecular Weight | 663.07700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H38S6 | Melting Point | 280ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-hexyl-5-[5-[5-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 280ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C36H38S6 |
| Molecular Weight | 663.07700 |
| Exact Mass | 662.13000 |
| PSA | 169.44000 |
| LogP | 14.63620 |
| InChIKey | QCMASTUHHXPVGT-UHFFFAOYSA-N |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(CCCCCC)s6)s5)s4)s3)s2)s1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Photovoltaic performance of organic solar cells based on DH6T/PCBM thin film active layers Muhammad, F. F.; et al.
Thin Solid Films 519 , 5230-5233, (2011)
|
| 5,5'''''-Dihexyl-2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-sexithiophene |
| MFCD06411295 |
| DH-6T |
| 2,2':5',2'':5'',2''':5''',2'''':5'''',2'''''-Sexithiophene,5,5'''''-dihexyl |
| |A,|O-Dihexylsexithiophene |