2,6-dinitropyridin-3-ol structure
|
Common Name | 2,6-dinitropyridin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 15128-91-3 | Molecular Weight | 185.09400 | |
| Density | 1.766g/cm3 | Boiling Point | 515.6ºC at 760mmHg | |
| Molecular Formula | C5H3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.6ºC | |
| Name | 2,6-dinitropyridin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.766g/cm3 |
|---|---|
| Boiling Point | 515.6ºC at 760mmHg |
| Molecular Formula | C5H3N3O5 |
| Molecular Weight | 185.09400 |
| Flash Point | 265.6ºC |
| Exact Mass | 185.00700 |
| PSA | 124.76000 |
| LogP | 1.65000 |
| Vapour Pressure | 3E-11mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | LFFZOHGXYHUOGO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])n1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Hydroxy-2,6-dinitropyridine |
| 2,6-dinitro-pyridin-3-ol |
| 3-Pyridinol,2,6-dinitro |
| 2,6-Dinitro-3-Pyridinol |