4(3H)-Pyrimidinone,6-amino-2-(trifluoromethyl)- structure
|
Common Name | 4(3H)-Pyrimidinone,6-amino-2-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1513-70-8 | Molecular Weight | 179.10000 | |
| Density | 1.75g/cm3 | Boiling Point | 166.6ºC at 760mmHg | |
| Molecular Formula | C5H4F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 54.6ºC | |
| Name | 6-amino-2-(trifluoromethyl)-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 166.6ºC at 760mmHg |
| Molecular Formula | C5H4F3N3O |
| Molecular Weight | 179.10000 |
| Flash Point | 54.6ºC |
| Exact Mass | 179.03100 |
| PSA | 71.77000 |
| LogP | 0.95210 |
| Vapour Pressure | 1.77mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | RCAWEPKTQGJPBV-UHFFFAOYSA-N |
| SMILES | Nc1cc(=O)[nH]c(C(F)(F)F)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| F2124-0817 |
| 6-amino-4-hydroxy-2-trifluoromethylpyrimidine |
| 6-amino-2-trifluoromethyl-3H-pyrimidin-4-one |
| 6-Amino-4-hydroxy-2-trifluormethyl-pyrimidin |