4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-(trifluoromethyl)- structure
|
Common Name | 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1513-71-9 | Molecular Weight | 195.09900 | |
| Density | 1.96g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H4F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.96g/cm3 |
|---|---|
| Molecular Formula | C5H4F3N3O2 |
| Molecular Weight | 195.09900 |
| Exact Mass | 195.02600 |
| PSA | 92.00000 |
| LogP | 0.65770 |
| Index of Refraction | 1.576 |
| InChIKey | NJYACEGAQHWMFA-UHFFFAOYSA-N |
| SMILES | Nc1c(O)nc(C(F)(F)F)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-amino-2-trifluoromethyl-1H-pyrimidine-4,6-dione |
| 5-Amino-4,6-dihydroxy-2-trifluormethyl-pyrimidin |